C16H13F3N4O4S2 — CID 121466983
3,3,3-trifluoropropyl N-[2-(2,3-dihydro-[1,3]thiazolo[4,5-c]pyridine-2-carbonylamino)thiophene-3-carbonyl]carbamate (PubChem CID 121466983) has the molecular formula C16H13F3N4O4S2 and a molecular weight of 446.43 g/mol. Its IUPAC name is 3,3,3-trifluoropropyl N-[2-(2,3-dihydro-[1,3]thiazolo[4,5-c]pyridine-2-carbonylamino)thiophene-3-carbonyl]carbamate.
| Compound Name | 3,3,3-trifluoropropyl N-[2-(2,3-dihydro-[1,3]thiazolo[4,5-c]pyridine-2-carbonylamino)thiophene-3-carbonyl]carbamate |
|---|---|
| PubChem CID | 121466983 |
| Molecular Formula | C16H13F3N4O4S2 |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 446.03 |
| IUPAC Name | 3,3,3-trifluoropropyl N-[2-(2,3-dihydro-[1,3]thiazolo[4,5-c]pyridine-2-carbonylamino)thiophene-3-carbonyl]carbamate |
| SMILES | O=C(NC(=O)c1ccsc1NC(=O)C1Nc2cnccc2S1)OCCC(F)(F)F |
| InChI | InChI=1S/C16H13F3N4O4S2/c17-16(18,19)3-5-27-15(26)23-11(24)8-2-6-28-13(8)22-12(25)14-21-9-7-20-4-1-10(9)29-14/h1-2,4,6-7,14,21H,3,5H2,(H,22,25)(H,23,24,26) |
| InChIKey | LVRWCSGMGPYUPY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |