C15H11F3N4O4S2 — CID 121466996
2,2,2-trifluoroethyl N-[2-(2,3-dihydro-[1,3]thiazolo[4,5-c]pyridine-2-carbonylamino)thiophene-3-carbonyl]carbamate (PubChem CID 121466996) has the molecular formula C15H11F3N4O4S2 and a molecular weight of 432.41 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[2-(2,3-dihydro-[1,3]thiazolo[4,5-c]pyridine-2-carbonylamino)thiophene-3-carbonyl]carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-[2-(2,3-dihydro-[1,3]thiazolo[4,5-c]pyridine-2-carbonylamino)thiophene-3-carbonyl]carbamate |
|---|---|
| PubChem CID | 121466996 |
| Molecular Formula | C15H11F3N4O4S2 |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.02 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[2-(2,3-dihydro-[1,3]thiazolo[4,5-c]pyridine-2-carbonylamino)thiophene-3-carbonyl]carbamate |
| SMILES | O=C(NC(=O)c1ccsc1NC(=O)C1Nc2cnccc2S1)OCC(F)(F)F |
| InChI | InChI=1S/C15H11F3N4O4S2/c16-15(17,18)6-26-14(25)22-10(23)7-2-4-27-12(7)21-11(24)13-20-8-5-19-3-1-9(8)28-13/h1-5,13,20H,6H2,(H,21,24)(H,22,23,25) |
| InChIKey | XJBHEWVLDPRIKZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |