C20H38O3 — CID 121475534
(E,3S,6R,10S,12R)-6-ethyl-3-hydroxy-12-methoxy-2,8,10-trimethyltetradec-7-en-5-one (PubChem CID 121475534) has the molecular formula C20H38O3 and a molecular weight of 326.52 g/mol. Its IUPAC name is (E,3S,6R,10S,12R)-6-ethyl-3-hydroxy-12-methoxy-2,8,10-trimethyltetradec-7-en-5-one.
| Compound Name | (E,3S,6R,10S,12R)-6-ethyl-3-hydroxy-12-methoxy-2,8,10-trimethyltetradec-7-en-5-one |
|---|---|
| PubChem CID | 121475534 |
| Molecular Formula | C20H38O3 |
| Molecular Weight | 326.52 g/mol |
| Exact Mass | 326.28 |
| IUPAC Name | (E,3S,6R,10S,12R)-6-ethyl-3-hydroxy-12-methoxy-2,8,10-trimethyltetradec-7-en-5-one |
| SMILES | CC[C@H](C[C@@H](C)C/C(C)=C/[C@@H](CC)C(=O)C[C@H](O)C(C)C)OC |
| InChI | InChI=1S/C20H38O3/c1-8-17(20(22)13-19(21)14(3)4)11-15(5)10-16(6)12-18(9-2)23-7/h11,14,16-19,21H,8-10,12-13H2,1-7H3/b15-11+/t16-,17+,18+,19-/m0/s1 |
| InChIKey | DTFALSWTTYDLLI-DEJOKYMKSA-N |
| XLogP | 4.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.52 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|