C14H23FO3 — CID 121475931
tert-butyl (4R)-4-fluoro-2-(2-methylpropanoyl)cyclopentane-1-carboxylate (PubChem CID 121475931) has the molecular formula C14H23FO3 and a molecular weight of 258.33 g/mol. Its IUPAC name is tert-butyl (4R)-4-fluoro-2-(2-methylpropanoyl)cyclopentane-1-carboxylate.
| Compound Name | tert-butyl (4R)-4-fluoro-2-(2-methylpropanoyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 121475931 |
| Molecular Formula | C14H23FO3 |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | tert-butyl (4R)-4-fluoro-2-(2-methylpropanoyl)cyclopentane-1-carboxylate |
| SMILES | CC(C)C(=O)C1C[C@@H](F)CC1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H23FO3/c1-8(2)12(16)10-6-9(15)7-11(10)13(17)18-14(3,4)5/h8-11H,6-7H2,1-5H3/t9-,10?,11?/m1/s1 |
| InChIKey | KQZVMOPFCCHHJR-KPPDAEKUSA-N |
| XLogP | 2.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |