C19H23O4P — CID 121477759
1-tert-butyl-4-(3-phenoxy-2-phosphorosooxypropoxy)benzene (PubChem CID 121477759) has the molecular formula C19H23O4P and a molecular weight of 346.36 g/mol. Its IUPAC name is 1-tert-butyl-4-(3-phenoxy-2-phosphorosooxypropoxy)benzene.
| Compound Name | 1-tert-butyl-4-(3-phenoxy-2-phosphorosooxypropoxy)benzene |
|---|---|
| PubChem CID | 121477759 |
| Molecular Formula | C19H23O4P |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 1-tert-butyl-4-(3-phenoxy-2-phosphorosooxypropoxy)benzene |
| SMILES | CC(C)(C)c1ccc(OCC(COc2ccccc2)OP=O)cc1 |
| InChI | InChI=1S/C19H23O4P/c1-19(2,3)15-9-11-17(12-10-15)22-14-18(23-24-20)13-21-16-7-5-4-6-8-16/h4-12,18H,13-14H2,1-3H3 |
| InChIKey | KHQHWRBTZMYRFW-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|