C18H36N2 — CID 121478737
4,4-diethyl-5-methyl-2-N-(3-methylbut-1-en-2-yl)-3-methylideneheptane-2,5-diamine (PubChem CID 121478737) has the molecular formula C18H36N2 and a molecular weight of 280.50 g/mol. Its IUPAC name is 4,4-diethyl-5-methyl-2-N-(3-methylbut-1-en-2-yl)-3-methylideneheptane-2,5-diamine.
| Compound Name | 4,4-diethyl-5-methyl-2-N-(3-methylbut-1-en-2-yl)-3-methylideneheptane-2,5-diamine |
|---|---|
| PubChem CID | 121478737 |
| Molecular Formula | C18H36N2 |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.29 |
| IUPAC Name | 4,4-diethyl-5-methyl-2-N-(3-methylbut-1-en-2-yl)-3-methylideneheptane-2,5-diamine |
| SMILES | C=C(NC(C)C(=C)C(CC)(CC)C(C)(N)CC)C(C)C |
| InChI | InChI=1S/C18H36N2/c1-10-17(9,19)18(11-2,12-3)14(6)16(8)20-15(7)13(4)5/h13,16,20H,6-7,10-12,19H2,1-5,8-9H3 |
| InChIKey | FREKWEPUEOSQEN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|