C17H36N2 — CID 89203764
1-N-(2,3-dimethylpent-1-en-3-yl)-5-N-ethyl-5-methylheptane-1,5-diamine (PubChem CID 89203764) has the molecular formula C17H36N2 and a molecular weight of 268.49 g/mol. Its IUPAC name is 1-N-(2,3-dimethylpent-1-en-3-yl)-5-N-ethyl-5-methylheptane-1,5-diamine.
| Compound Name | 1-N-(2,3-dimethylpent-1-en-3-yl)-5-N-ethyl-5-methylheptane-1,5-diamine |
|---|---|
| PubChem CID | 89203764 |
| Molecular Formula | C17H36N2 |
| Molecular Weight | 268.49 g/mol |
| Exact Mass | 268.29 |
| IUPAC Name | 1-N-(2,3-dimethylpent-1-en-3-yl)-5-N-ethyl-5-methylheptane-1,5-diamine |
| SMILES | C=C(C)C(C)(CC)NCCCCC(C)(CC)NCC |
| InChI | InChI=1S/C17H36N2/c1-8-16(6,18-10-3)13-11-12-14-19-17(7,9-2)15(4)5/h18-19H,4,8-14H2,1-3,5-7H3 |
| InChIKey | FUTCJFHDFCOGAA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|