C16H20ClFN2O3 — CID 122018821
3-[[4-[(4-chlorophenyl)methyl]-4-fluoropiperidine-1-carbonyl]amino]propanoic acid (PubChem CID 122018821) has the molecular formula C16H20ClFN2O3 and a molecular weight of 342.80 g/mol. Its IUPAC name is 3-[[4-[(4-chlorophenyl)methyl]-4-fluoropiperidine-1-carbonyl]amino]propanoic acid.
| Compound Name | 3-[[4-[(4-chlorophenyl)methyl]-4-fluoropiperidine-1-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122018821 |
| Molecular Formula | C16H20ClFN2O3 |
| Molecular Weight | 342.80 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 3-[[4-[(4-chlorophenyl)methyl]-4-fluoropiperidine-1-carbonyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)N1CCC(F)(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H20ClFN2O3/c17-13-3-1-12(2-4-13)11-16(18)6-9-20(10-7-16)15(23)19-8-5-14(21)22/h1-4H,5-11H2,(H,19,23)(H,21,22) |
| InChIKey | DCTBUFKKOXOHRN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.80 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |