C16H19N3O5S — CID 122023144
4-[[4-(thieno[3,2-b]furan-5-carbonyl)piperazine-1-carbonyl]amino]butanoic acid (PubChem CID 122023144) has the molecular formula C16H19N3O5S and a molecular weight of 365.41 g/mol. Its IUPAC name is 4-[[4-(thieno[3,2-b]furan-5-carbonyl)piperazine-1-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[4-(thieno[3,2-b]furan-5-carbonyl)piperazine-1-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 122023144 |
| Molecular Formula | C16H19N3O5S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 4-[[4-(thieno[3,2-b]furan-5-carbonyl)piperazine-1-carbonyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)N1CCN(C(=O)c2cc3occc3s2)CC1 |
| InChI | InChI=1S/C16H19N3O5S/c20-14(21)2-1-4-17-16(23)19-7-5-18(6-8-19)15(22)13-10-11-12(25-13)3-9-24-11/h3,9-10H,1-2,4-8H2,(H,17,23)(H,20,21) |
| InChIKey | FTFKBUYOCZUMIA-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|