C16H20ClF3N2O3 — CID 122039862
2-[[4-[4-chloro-3-(trifluoromethyl)anilino]-4-oxobutan-2-yl]amino]pentanoic acid (PubChem CID 122039862) has the molecular formula C16H20ClF3N2O3 and a molecular weight of 380.79 g/mol. Its IUPAC name is 2-[[4-[4-chloro-3-(trifluoromethyl)anilino]-4-oxobutan-2-yl]amino]pentanoic acid.
| Compound Name | 2-[[4-[4-chloro-3-(trifluoromethyl)anilino]-4-oxobutan-2-yl]amino]pentanoic acid |
|---|---|
| PubChem CID | 122039862 |
| Molecular Formula | C16H20ClF3N2O3 |
| Molecular Weight | 380.79 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 2-[[4-[4-chloro-3-(trifluoromethyl)anilino]-4-oxobutan-2-yl]amino]pentanoic acid |
| SMILES | CCCC(NC(C)CC(=O)Nc1ccc(Cl)c(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C16H20ClF3N2O3/c1-3-4-13(15(24)25)21-9(2)7-14(23)22-10-5-6-12(17)11(8-10)16(18,19)20/h5-6,8-9,13,21H,3-4,7H2,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | SBUNMCUNWSMXLT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.79 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |