C19H19F4NO2 — CID 122046088
4-[[4-fluoro-2-(trifluoromethyl)phenyl]methylamino]-5-phenylpentanoic acid (PubChem CID 122046088) has the molecular formula C19H19F4NO2 and a molecular weight of 369.36 g/mol. Its IUPAC name is 4-[[4-fluoro-2-(trifluoromethyl)phenyl]methylamino]-5-phenylpentanoic acid.
| Compound Name | 4-[[4-fluoro-2-(trifluoromethyl)phenyl]methylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122046088 |
| Molecular Formula | C19H19F4NO2 |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 4-[[4-fluoro-2-(trifluoromethyl)phenyl]methylamino]-5-phenylpentanoic acid |
| SMILES | O=C(O)CCC(Cc1ccccc1)NCc1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C19H19F4NO2/c20-15-7-6-14(17(11-15)19(21,22)23)12-24-16(8-9-18(25)26)10-13-4-2-1-3-5-13/h1-7,11,16,24H,8-10,12H2,(H,25,26) |
| InChIKey | QHKKWKZRLLJYNN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |