C16H22N6O2 — CID 122061973
2-[ethyl-[3-[[1-(4-methylphenyl)tetrazol-5-yl]amino]cyclobutyl]amino]acetic acid (PubChem CID 122061973) has the molecular formula C16H22N6O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is 2-[ethyl-[3-[[1-(4-methylphenyl)tetrazol-5-yl]amino]cyclobutyl]amino]acetic acid.
| Compound Name | 2-[ethyl-[3-[[1-(4-methylphenyl)tetrazol-5-yl]amino]cyclobutyl]amino]acetic acid |
|---|---|
| PubChem CID | 122061973 |
| Molecular Formula | C16H22N6O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 2-[ethyl-[3-[[1-(4-methylphenyl)tetrazol-5-yl]amino]cyclobutyl]amino]acetic acid |
| SMILES | CCN(CC(=O)O)C1CC(Nc2nnnn2-c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C16H22N6O2/c1-3-21(10-15(23)24)14-8-12(9-14)17-16-18-19-20-22(16)13-6-4-11(2)5-7-13/h4-7,12,14H,3,8-10H2,1-2H3,(H,23,24)(H,17,18,20) |
| InChIKey | LMYDCGLLDJIQGF-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |