C18H24N4O2S — CID 122062004
2-[ethyl-[3-[(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]cyclobutyl]amino]acetic acid (PubChem CID 122062004) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is 2-[ethyl-[3-[(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]cyclobutyl]amino]acetic acid.
| Compound Name | 2-[ethyl-[3-[(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]cyclobutyl]amino]acetic acid |
|---|---|
| PubChem CID | 122062004 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 2-[ethyl-[3-[(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]cyclobutyl]amino]acetic acid |
| SMILES | CCN(CC(=O)O)C1CC(Nc2nc(C)nc3sc4c(c23)CCC4)C1 |
| InChI | InChI=1S/C18H24N4O2S/c1-3-22(9-15(23)24)12-7-11(8-12)21-17-16-13-5-4-6-14(13)25-18(16)20-10(2)19-17/h11-12H,3-9H2,1-2H3,(H,23,24)(H,19,20,21) |
| InChIKey | LSJRDTWWPNCWGF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |