C19H23N3O6 — CID 122065155
2-[2-acetamidoethyl-[2-(5-methyl-1,3-dioxoisoindol-2-yl)propanoyl]amino]propanoic acid (PubChem CID 122065155) has the molecular formula C19H23N3O6 and a molecular weight of 389.41 g/mol. Its IUPAC name is 2-[2-acetamidoethyl-[2-(5-methyl-1,3-dioxoisoindol-2-yl)propanoyl]amino]propanoic acid.
| Compound Name | 2-[2-acetamidoethyl-[2-(5-methyl-1,3-dioxoisoindol-2-yl)propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122065155 |
| Molecular Formula | C19H23N3O6 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 2-[2-acetamidoethyl-[2-(5-methyl-1,3-dioxoisoindol-2-yl)propanoyl]amino]propanoic acid |
| SMILES | CC(=O)NCCN(C(=O)C(C)N1C(=O)c2ccc(C)cc2C1=O)C(C)C(=O)O |
| InChI | InChI=1S/C19H23N3O6/c1-10-5-6-14-15(9-10)18(26)22(17(14)25)11(2)16(24)21(12(3)19(27)28)8-7-20-13(4)23/h5-6,9,11-12H,7-8H2,1-4H3,(H,20,23)(H,27,28) |
| InChIKey | NGHZTDPSXWXCII-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|