C12H11F4NO5S — CID 122068414
1-[2-fluoro-6-(trifluoromethoxy)phenyl]sulfonylpyrrolidine-3-carboxylic acid (PubChem CID 122068414) has the molecular formula C12H11F4NO5S and a molecular weight of 357.28 g/mol. Its IUPAC name is 1-[2-fluoro-6-(trifluoromethoxy)phenyl]sulfonylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-[2-fluoro-6-(trifluoromethoxy)phenyl]sulfonylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122068414 |
| Molecular Formula | C12H11F4NO5S |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | 1-[2-fluoro-6-(trifluoromethoxy)phenyl]sulfonylpyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCN(S(=O)(=O)c2c(F)cccc2OC(F)(F)F)C1 |
| InChI | InChI=1S/C12H11F4NO5S/c13-8-2-1-3-9(22-12(14,15)16)10(8)23(20,21)17-5-4-7(6-17)11(18)19/h1-3,7H,4-6H2,(H,18,19) |
| InChIKey | WVHPEMWFUJINAD-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |