C14H20N4 — CID 122096089
N'-[(1-pyridin-2-ylcyclobutyl)methyl]azetidine-1-carboximidamide (PubChem CID 122096089) has the molecular formula C14H20N4 and a molecular weight of 244.34 g/mol. Its IUPAC name is N'-[(1-pyridin-2-ylcyclobutyl)methyl]azetidine-1-carboximidamide.
| Compound Name | N'-[(1-pyridin-2-ylcyclobutyl)methyl]azetidine-1-carboximidamide |
|---|---|
| PubChem CID | 122096089 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | N'-[(1-pyridin-2-ylcyclobutyl)methyl]azetidine-1-carboximidamide |
| SMILES | N/C(=N\CC1(c2ccccn2)CCC1)N1CCC1 |
| InChI | InChI=1S/C14H20N4/c15-13(18-9-4-10-18)17-11-14(6-3-7-14)12-5-1-2-8-16-12/h1-2,5,8H,3-4,6-7,9-11H2,(H2,15,17) |
| InChIKey | DHPALZXXXSUQDF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 54.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|