C15H13F2N3O2S2 — CID 122161499
2,6-difluoro-N-(2-pyrazol-1-yl-2-thiophen-3-ylethyl)benzenesulfonamide (PubChem CID 122161499) has the molecular formula C15H13F2N3O2S2 and a molecular weight of 369.42 g/mol. Its IUPAC name is 2,6-difluoro-N-(2-pyrazol-1-yl-2-thiophen-3-ylethyl)benzenesulfonamide.
| Compound Name | 2,6-difluoro-N-(2-pyrazol-1-yl-2-thiophen-3-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 122161499 |
| Molecular Formula | C15H13F2N3O2S2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 2,6-difluoro-N-(2-pyrazol-1-yl-2-thiophen-3-ylethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC(c1ccsc1)n1cccn1)c1c(F)cccc1F |
| InChI | InChI=1S/C15H13F2N3O2S2/c16-12-3-1-4-13(17)15(12)24(21,22)19-9-14(11-5-8-23-10-11)20-7-2-6-18-20/h1-8,10,14,19H,9H2 |
| InChIKey | LRMPSBKSHKNVKV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |