C25H31N3O2 — CID 122169637
2-[2-[(9R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-oxoethyl]-3H-isoindol-1-one (PubChem CID 122169637) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is 2-[2-[(9R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-oxoethyl]-3H-isoindol-1-one.
| Compound Name | 2-[2-[(9R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-oxoethyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 122169637 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 2-[2-[(9R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl]-2-oxoethyl]-3H-isoindol-1-one |
| SMILES | O=C1c2ccccc2CN1CC(=O)N1CCCC2=C[C@H]3CC(CN4CCCCC34)C21 |
| InChI | InChI=1S/C25H31N3O2/c29-23(16-27-14-18-6-1-2-8-21(18)25(27)30)28-11-5-7-17-12-19-13-20(24(17)28)15-26-10-4-3-9-22(19)26/h1-2,6,8,12,19-20,22,24H,3-5,7,9-11,13-16H2/t19-,20?,22?,24?/m0/s1 |
| InChIKey | YANKGUFDQNGLKJ-IMSWZGAWSA-N |
| XLogP | 3.06 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|