C9H10F3N3O5 — CID 122171623
2-methyl-3-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]propanoic acid (PubChem CID 122171623) has the molecular formula C9H10F3N3O5 and a molecular weight of 297.19 g/mol. Its IUPAC name is 2-methyl-3-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]propanoic acid.
| Compound Name | 2-methyl-3-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 122171623 |
| Molecular Formula | C9H10F3N3O5 |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 2-methyl-3-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]propanoic acid |
| SMILES | CC(Cn1cc([N+](=O)[O-])c(OCC(F)(F)F)n1)C(=O)O |
| InChI | InChI=1S/C9H10F3N3O5/c1-5(8(16)17)2-14-3-6(15(18)19)7(13-14)20-4-9(10,11)12/h3,5H,2,4H2,1H3,(H,16,17) |
| InChIKey | GZWQENOQFFUOAI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|