C18H17ClN2O2 — CID 122184999
4-[1-(3-chlorophenyl)ethyl]-6,7-dimethoxyquinazoline (PubChem CID 122184999) has the molecular formula C18H17ClN2O2 and a molecular weight of 328.80 g/mol. Its IUPAC name is 4-[1-(3-chlorophenyl)ethyl]-6,7-dimethoxyquinazoline.
| Compound Name | 4-[1-(3-chlorophenyl)ethyl]-6,7-dimethoxyquinazoline |
|---|---|
| PubChem CID | 122184999 |
| Molecular Formula | C18H17ClN2O2 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 4-[1-(3-chlorophenyl)ethyl]-6,7-dimethoxyquinazoline |
| SMILES | COc1cc2ncnc(C(C)c3cccc(Cl)c3)c2cc1OC |
| InChI | InChI=1S/C18H17ClN2O2/c1-11(12-5-4-6-13(19)7-12)18-14-8-16(22-2)17(23-3)9-15(14)20-10-21-18/h4-11H,1-3H3 |
| InChIKey | ROVZHCNAFFDJBQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |