C29H38N6O6S — CID 122193366
S-[(E)-4-[(5S,9R,12R,15R)-9-benzyl-12-methyl-3,7,10,13-tetraoxo-15-propan-2-yl-4-oxa-1,8,11,14,17,18-hexazabicyclo[14.2.1]nonadeca-16(19),17-dien-5-yl]but-3-enyl] ethanethioate (PubChem CID 122193366) has the molecular formula C29H38N6O6S and a molecular weight of 598.73 g/mol. Its IUPAC name is S-[(E)-4-[(5S,9R,12R,15R)-9-benzyl-12-methyl-3,7,10,13-tetraoxo-15-propan-2-yl-4-oxa-1,8,11,14,17,18-hexazabicyclo[14.2.1]nonadeca-16(19),17-dien-5-yl]but-3-enyl] ethanethioate.
| Compound Name | S-[(E)-4-[(5S,9R,12R,15R)-9-benzyl-12-methyl-3,7,10,13-tetraoxo-15-propan-2-yl-4-oxa-1,8,11,14,17,18-hexazabicyclo[14.2.1]nonadeca-16(19),17-dien-5-yl]but-3-enyl] ethanethioate |
|---|---|
| PubChem CID | 122193366 |
| Molecular Formula | C29H38N6O6S |
| Molecular Weight | 598.73 g/mol |
| Exact Mass | 598.26 |
| IUPAC Name | S-[(E)-4-[(5S,9R,12R,15R)-9-benzyl-12-methyl-3,7,10,13-tetraoxo-15-propan-2-yl-4-oxa-1,8,11,14,17,18-hexazabicyclo[14.2.1]nonadeca-16(19),17-dien-5-yl]but-3-enyl] ethanethioate |
| SMILES | CC(=O)SCC/C=C/[C@@H]1CC(=O)N[C@H](Cc2ccccc2)C(=O)N[C@H](C)C(=O)N[C@H](C(C)C)c2cn(nn2)CC(=O)O1 |
| InChI | InChI=1S/C29H38N6O6S/c1-18(2)27-24-16-35(34-33-24)17-26(38)41-22(12-8-9-13-42-20(4)36)15-25(37)31-23(14-21-10-6-5-7-11-21)29(40)30-19(3)28(39)32-27/h5-8,10-12,16,18-19,22-23,27H,9,13-15,17H2,1-4H3,(H,30,40)(H,31,37)(H,32,39)/b12-8+/t19-,22-,23-,27-/m1/s1 |
| InChIKey | XPRFOMLCEXGSPZ-RHLXARMISA-N |
| XLogP | 1.87 |
| TPSA | 161.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.73 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|