C20H32N4O6S2 — CID 88927603
(6R,9R,12R,16S)-12-methyl-6-propan-2-yl-16-[(E)-4-sulfanylbut-1-enyl]-9-(sulfanylmethyl)-1-oxa-4,7,10,13-tetrazacyclohexadecane-2,5,8,11,14-pentone (PubChem CID 88927603) has the molecular formula C20H32N4O6S2 and a molecular weight of 488.63 g/mol. Its IUPAC name is (6R,9R,12R,16S)-12-methyl-6-propan-2-yl-16-[(E)-4-sulfanylbut-1-enyl]-9-(sulfanylmethyl)-1-oxa-4,7,10,13-tetrazacyclohexadecane-2,5,8,11,14-pentone.
| Compound Name | (6R,9R,12R,16S)-12-methyl-6-propan-2-yl-16-[(E)-4-sulfanylbut-1-enyl]-9-(sulfanylmethyl)-1-oxa-4,7,10,13-tetrazacyclohexadecane-2,5,8,11,14-pentone |
|---|---|
| PubChem CID | 88927603 |
| Molecular Formula | C20H32N4O6S2 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | (6R,9R,12R,16S)-12-methyl-6-propan-2-yl-16-[(E)-4-sulfanylbut-1-enyl]-9-(sulfanylmethyl)-1-oxa-4,7,10,13-tetrazacyclohexadecane-2,5,8,11,14-pentone |
| SMILES | CC(C)[C@H]1NC(=O)[C@H](CS)NC(=O)[C@@H](C)NC(=O)C[C@@H](/C=C/CCS)OC(=O)CNC1=O |
| InChI | InChI=1S/C20H32N4O6S2/c1-11(2)17-20(29)21-9-16(26)30-13(6-4-5-7-31)8-15(25)22-12(3)18(27)23-14(10-32)19(28)24-17/h4,6,11-14,17,31-32H,5,7-10H2,1-3H3,(H,21,29)(H,22,25)(H,23,27)(H,24,28)/b6-4+/t12-,13-,14+,17-/m1/s1 |
| InChIKey | MLNRUTUNOQBPJF-BHYMCBLZSA-N |
| XLogP | -0.65 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|