C23H36N4O5S2 — CID 143470330
(1S,3Z,8R)-3-ethylidene-15-methyl-11-propan-2-yl-8-[(E)-4-sulfanylbut-1-enyl]-9-oxa-16-thia-2,5,12,19-tetrazabicyclo[12.3.2]nonadecane-6,10,13,18-tetrone (PubChem CID 143470330) has the molecular formula C23H36N4O5S2 and a molecular weight of 512.70 g/mol. Its IUPAC name is (1S,3Z,8R)-3-ethylidene-15-methyl-11-propan-2-yl-8-[(E)-4-sulfanylbut-1-enyl]-9-oxa-16-thia-2,5,12,19-tetrazabicyclo[12.3.2]nonadecane-6,10,13,18-tetrone.
| Compound Name | (1S,3Z,8R)-3-ethylidene-15-methyl-11-propan-2-yl-8-[(E)-4-sulfanylbut-1-enyl]-9-oxa-16-thia-2,5,12,19-tetrazabicyclo[12.3.2]nonadecane-6,10,13,18-tetrone |
|---|---|
| PubChem CID | 143470330 |
| Molecular Formula | C23H36N4O5S2 |
| Molecular Weight | 512.70 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | (1S,3Z,8R)-3-ethylidene-15-methyl-11-propan-2-yl-8-[(E)-4-sulfanylbut-1-enyl]-9-oxa-16-thia-2,5,12,19-tetrazabicyclo[12.3.2]nonadecane-6,10,13,18-tetrone |
| SMILES | C/C=C1/CNC(=O)C[C@H](/C=C/CCS)OC(=O)C(C(C)C)NC(=O)C2NC(=O)[C@@H](CSC2C)N1 |
| InChI | InChI=1S/C23H36N4O5S2/c1-5-15-11-24-18(28)10-16(8-6-7-9-33)32-23(31)19(13(2)3)26-22(30)20-14(4)34-12-17(25-15)21(29)27-20/h5-6,8,13-14,16-17,19-20,25,33H,7,9-12H2,1-4H3,(H,24,28)(H,26,30)(H,27,29)/b8-6+,15-5-/t14?,16-,17+,19?,20?/m0/s1 |
| InChIKey | CJBNVUCVXCICLA-YBPYQNCPSA-N |
| XLogP | 0.92 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.70 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|