C30H41N3O8S2 — CID 91218133
S-[4-[(2S,6R,9S,12R,13S)-9-(acetylsulfanylmethyl)-6-benzyl-13-hydroxy-4,7,10,15-tetraoxo-12-propan-2-yl-1-oxa-5,8,11-triazacyclopentadec-2-yl]but-3-enyl] ethanethioate (PubChem CID 91218133) has the molecular formula C30H41N3O8S2 and a molecular weight of 635.81 g/mol. Its IUPAC name is S-[4-[(2S,6R,9S,12R,13S)-9-(acetylsulfanylmethyl)-6-benzyl-13-hydroxy-4,7,10,15-tetraoxo-12-propan-2-yl-1-oxa-5,8,11-triazacyclopentadec-2-yl]but-3-enyl] ethanethioate.
| Compound Name | S-[4-[(2S,6R,9S,12R,13S)-9-(acetylsulfanylmethyl)-6-benzyl-13-hydroxy-4,7,10,15-tetraoxo-12-propan-2-yl-1-oxa-5,8,11-triazacyclopentadec-2-yl]but-3-enyl] ethanethioate |
|---|---|
| PubChem CID | 91218133 |
| Molecular Formula | C30H41N3O8S2 |
| Molecular Weight | 635.81 g/mol |
| Exact Mass | 635.23 |
| IUPAC Name | S-[4-[(2S,6R,9S,12R,13S)-9-(acetylsulfanylmethyl)-6-benzyl-13-hydroxy-4,7,10,15-tetraoxo-12-propan-2-yl-1-oxa-5,8,11-triazacyclopentadec-2-yl]but-3-enyl] ethanethioate |
| SMILES | CC(=O)SCCC=C[C@@H]1CC(=O)N[C@H](Cc2ccccc2)C(=O)N[C@H](CSC(C)=O)C(=O)N[C@H](C(C)C)[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C30H41N3O8S2/c1-18(2)28-25(36)16-27(38)41-22(12-8-9-13-42-19(3)34)15-26(37)31-23(14-21-10-6-5-7-11-21)29(39)32-24(30(40)33-28)17-43-20(4)35/h5-8,10-12,18,22-25,28,36H,9,13-17H2,1-4H3,(H,31,37)(H,32,39)(H,33,40)/t22-,23-,24-,25+,28-/m1/s1 |
| InChIKey | QSOLTPUKBKBFQS-MCGNWXOFSA-N |
| XLogP | 1.91 |
| TPSA | 167.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.81 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|