C15H15ClN2O4S — CID 122195242
phenyl 4-(2-chloroethylcarbamoylamino)benzenesulfonate (PubChem CID 122195242) has the molecular formula C15H15ClN2O4S and a molecular weight of 354.82 g/mol. Its IUPAC name is phenyl 4-(2-chloroethylcarbamoylamino)benzenesulfonate.
| Compound Name | phenyl 4-(2-chloroethylcarbamoylamino)benzenesulfonate |
|---|---|
| PubChem CID | 122195242 |
| Molecular Formula | C15H15ClN2O4S |
| Molecular Weight | 354.82 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | phenyl 4-(2-chloroethylcarbamoylamino)benzenesulfonate |
| SMILES | O=C(NCCCl)Nc1ccc(S(=O)(=O)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C15H15ClN2O4S/c16-10-11-17-15(19)18-12-6-8-14(9-7-12)23(20,21)22-13-4-2-1-3-5-13/h1-9H,10-11H2,(H2,17,18,19) |
| InChIKey | KYMMWUYTUSOONB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.82 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|