C23H18N2O5S — CID 172730685
[4-(phenoxycarbamoylamino)phenyl] naphthalene-2-sulfonate (PubChem CID 172730685) has the molecular formula C23H18N2O5S and a molecular weight of 434.47 g/mol. Its IUPAC name is [4-(phenoxycarbamoylamino)phenyl] naphthalene-2-sulfonate.
| Compound Name | [4-(phenoxycarbamoylamino)phenyl] naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 172730685 |
| Molecular Formula | C23H18N2O5S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | [4-(phenoxycarbamoylamino)phenyl] naphthalene-2-sulfonate |
| SMILES | O=C(NOc1ccccc1)Nc1ccc(OS(=O)(=O)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C23H18N2O5S/c26-23(25-29-20-8-2-1-3-9-20)24-19-11-13-21(14-12-19)30-31(27,28)22-15-10-17-6-4-5-7-18(17)16-22/h1-16H,(H2,24,25,26) |
| InChIKey | HTEQSJMIYOBUCM-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|