C15H16F4O — CID 122202290
1,2,4,5-tetrafluoro-3-methoxy-6-octa-1,7-dien-3-ylbenzene (PubChem CID 122202290) has the molecular formula C15H16F4O and a molecular weight of 288.28 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-methoxy-6-octa-1,7-dien-3-ylbenzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-methoxy-6-octa-1,7-dien-3-ylbenzene |
|---|---|
| PubChem CID | 122202290 |
| Molecular Formula | C15H16F4O |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-methoxy-6-octa-1,7-dien-3-ylbenzene |
| SMILES | C=CCCCC(C=C)c1c(F)c(F)c(OC)c(F)c1F |
| InChI | InChI=1S/C15H16F4O/c1-4-6-7-8-9(5-2)10-11(16)13(18)15(20-3)14(19)12(10)17/h4-5,9H,1-2,6-8H2,3H3 |
| InChIKey | UQJGBCOSNPZCNH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|