C22H27N7O — CID 122204823
3-[6-(1,2,4-triazin-3-yl)-4-undec-10-enoxy-2-pyridinyl]-1,2,4-triazine (PubChem CID 122204823) has the molecular formula C22H27N7O and a molecular weight of 405.51 g/mol. Its IUPAC name is 3-[6-(1,2,4-triazin-3-yl)-4-undec-10-enoxy-2-pyridinyl]-1,2,4-triazine.
| Compound Name | 3-[6-(1,2,4-triazin-3-yl)-4-undec-10-enoxy-2-pyridinyl]-1,2,4-triazine |
|---|---|
| PubChem CID | 122204823 |
| Molecular Formula | C22H27N7O |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 3-[6-(1,2,4-triazin-3-yl)-4-undec-10-enoxy-2-pyridinyl]-1,2,4-triazine |
| SMILES | C=CCCCCCCCCCOc1cc(-c2nccnn2)nc(-c2nccnn2)c1 |
| InChI | InChI=1S/C22H27N7O/c1-2-3-4-5-6-7-8-9-10-15-30-18-16-19(21-23-11-13-25-28-21)27-20(17-18)22-24-12-14-26-29-22/h2,11-14,16-17H,1,3-10,15H2 |
| InChIKey | LQXSLMZTFBMXOG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 99.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|