C15H24BF2O3- — CID 122208545
(2,4-difluorophenyl)-tri(propan-2-yloxy)boranuide (PubChem CID 122208545) has the molecular formula C15H24BF2O3- and a molecular weight of 301.16 g/mol. Its IUPAC name is (2,4-difluorophenyl)-tri(propan-2-yloxy)boranuide.
| Compound Name | (2,4-difluorophenyl)-tri(propan-2-yloxy)boranuide |
|---|---|
| PubChem CID | 122208545 |
| Molecular Formula | C15H24BF2O3- |
| Molecular Weight | 301.16 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | (2,4-difluorophenyl)-tri(propan-2-yloxy)boranuide |
| SMILES | CC(C)O[B-](OC(C)C)(OC(C)C)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H24BF2O3/c1-10(2)19-16(20-11(3)4,21-12(5)6)14-8-7-13(17)9-15(14)18/h7-12H,1-6H3/q-1 |
| InChIKey | FTRNABZGFITRTL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.16 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|