C24H33NO2SSi — CID 122209826
N-[(2R)-5-[dimethyl(phenyl)silyl]-1-phenylmethoxypenta-3,4-dien-2-yl]-2-methylpropane-2-sulfinamide (PubChem CID 122209826) has the molecular formula C24H33NO2SSi and a molecular weight of 427.69 g/mol. Its IUPAC name is N-[(2R)-5-[dimethyl(phenyl)silyl]-1-phenylmethoxypenta-3,4-dien-2-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[(2R)-5-[dimethyl(phenyl)silyl]-1-phenylmethoxypenta-3,4-dien-2-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 122209826 |
| Molecular Formula | C24H33NO2SSi |
| Molecular Weight | 427.69 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | N-[(2R)-5-[dimethyl(phenyl)silyl]-1-phenylmethoxypenta-3,4-dien-2-yl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)N[C@H](C=C=C[Si](C)(C)c1ccccc1)COCc1ccccc1 |
| InChI | InChI=1S/C24H33NO2SSi/c1-24(2,3)28(26)25-22(20-27-19-21-13-8-6-9-14-21)15-12-18-29(4,5)23-16-10-7-11-17-23/h6-11,13-18,22,25H,19-20H2,1-5H3/t12?,22-,28?/m1/s1 |
| InChIKey | JKDKEOYYDOCNBK-KNTWSMHISA-N |
| XLogP | 4.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.69 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|