C13H19NO — CID 122210753
1-(2-ethenoxyethyl)-7-methyl-4,5,6,7-tetrahydroindole (PubChem CID 122210753) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 1-(2-ethenoxyethyl)-7-methyl-4,5,6,7-tetrahydroindole.
| Compound Name | 1-(2-ethenoxyethyl)-7-methyl-4,5,6,7-tetrahydroindole |
|---|---|
| PubChem CID | 122210753 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 1-(2-ethenoxyethyl)-7-methyl-4,5,6,7-tetrahydroindole |
| SMILES | C=COCCn1ccc2c1C(C)CCC2 |
| InChI | InChI=1S/C13H19NO/c1-3-15-10-9-14-8-7-12-6-4-5-11(2)13(12)14/h3,7-8,11H,1,4-6,9-10H2,2H3 |
| InChIKey | PPHVMUKJGWLKCB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|