C21H14ClN3O — CID 122212018
19-chloro-5-methyl-8,13,15-triazahexacyclo[10.9.2.02,7.09,22.015,23.016,21]tricosa-1,7,9(22),10,12(23),13,16(21),17,19-nonaen-3-one (PubChem CID 122212018) has the molecular formula C21H14ClN3O and a molecular weight of 359.82 g/mol. Its IUPAC name is 19-chloro-5-methyl-8,13,15-triazahexacyclo[10.9.2.02,7.09,22.015,23.016,21]tricosa-1,7,9(22),10,12(23),13,16(21),17,19-nonaen-3-one.
| Compound Name | 19-chloro-5-methyl-8,13,15-triazahexacyclo[10.9.2.02,7.09,22.015,23.016,21]tricosa-1,7,9(22),10,12(23),13,16(21),17,19-nonaen-3-one |
|---|---|
| PubChem CID | 122212018 |
| Molecular Formula | C21H14ClN3O |
| Molecular Weight | 359.82 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 19-chloro-5-methyl-8,13,15-triazahexacyclo[10.9.2.02,7.09,22.015,23.016,21]tricosa-1,7,9(22),10,12(23),13,16(21),17,19-nonaen-3-one |
| SMILES | CC1CC(=O)c2c(nc3ccc4ncn5c6ccc(Cl)cc6c2c3c45)C1 |
| InChI | InChI=1S/C21H14ClN3O/c1-10-6-15-19(17(26)7-10)18-12-8-11(22)2-5-16(12)25-9-23-14-4-3-13(24-15)20(18)21(14)25/h2-5,8-10H,6-7H2,1H3 |
| InChIKey | KKZJZYXBTMBNGF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.82 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|