C20H13FN4O — CID 139236586
18-fluoro-5-methyl-8,13,14,15-tetrazahexacyclo[10.9.2.02,7.09,22.015,23.016,21]tricosa-1,7,9(22),10,12(23),13,16(21),17,19-nonaen-3-one (PubChem CID 139236586) has the molecular formula C20H13FN4O and a molecular weight of 344.35 g/mol. Its IUPAC name is 18-fluoro-5-methyl-8,13,14,15-tetrazahexacyclo[10.9.2.02,7.09,22.015,23.016,21]tricosa-1,7,9(22),10,12(23),13,16(21),17,19-nonaen-3-one.
| Compound Name | 18-fluoro-5-methyl-8,13,14,15-tetrazahexacyclo[10.9.2.02,7.09,22.015,23.016,21]tricosa-1,7,9(22),10,12(23),13,16(21),17,19-nonaen-3-one |
|---|---|
| PubChem CID | 139236586 |
| Molecular Formula | C20H13FN4O |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 18-fluoro-5-methyl-8,13,14,15-tetrazahexacyclo[10.9.2.02,7.09,22.015,23.016,21]tricosa-1,7,9(22),10,12(23),13,16(21),17,19-nonaen-3-one |
| SMILES | CC1CC(=O)c2c(nc3ccc4nnn5c6cc(F)ccc6c2c3c45)C1 |
| InChI | InChI=1S/C20H13FN4O/c1-9-6-14-18(16(26)7-9)17-11-3-2-10(21)8-15(11)25-20-13(23-24-25)5-4-12(22-14)19(17)20/h2-5,8-9H,6-7H2,1H3 |
| InChIKey | YZHZDQSCMJWWOO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 60.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|