C17H16FN5O — CID 46231191
10-[2-(dimethylamino)ethylamino]-5-fluoro-1,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-8-one (PubChem CID 46231191) has the molecular formula C17H16FN5O and a molecular weight of 325.35 g/mol. Its IUPAC name is 10-[2-(dimethylamino)ethylamino]-5-fluoro-1,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-8-one.
| Compound Name | 10-[2-(dimethylamino)ethylamino]-5-fluoro-1,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-8-one |
|---|---|
| PubChem CID | 46231191 |
| Molecular Formula | C17H16FN5O |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 10-[2-(dimethylamino)ethylamino]-5-fluoro-1,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-8-one |
| SMILES | CN(C)CCNc1ccc2nnn3c4ccc(F)cc4c(=O)c1c23 |
| InChI | InChI=1S/C17H16FN5O/c1-22(2)8-7-19-12-4-5-13-16-15(12)17(24)11-9-10(18)3-6-14(11)23(16)21-20-13/h3-6,9,19H,7-8H2,1-2H3 |
| InChIKey | FHMKFFXXWVASCK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|