C17H35B2NO4 — CID 122213031
N-tert-butyl-4,4,5,5-tetramethyl-N-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-1,3,2-dioxaborolan-2-amine (PubChem CID 122213031) has the molecular formula C17H35B2NO4 and a molecular weight of 339.09 g/mol. Its IUPAC name is N-tert-butyl-4,4,5,5-tetramethyl-N-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-1,3,2-dioxaborolan-2-amine.
| Compound Name | N-tert-butyl-4,4,5,5-tetramethyl-N-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-1,3,2-dioxaborolan-2-amine |
|---|---|
| PubChem CID | 122213031 |
| Molecular Formula | C17H35B2NO4 |
| Molecular Weight | 339.09 g/mol |
| Exact Mass | 339.28 |
| IUPAC Name | N-tert-butyl-4,4,5,5-tetramethyl-N-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-1,3,2-dioxaborolan-2-amine |
| SMILES | CC(C)(C)N(CB1OC(C)(C)C(C)(C)O1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H35B2NO4/c1-13(2,3)20(19-23-16(8,9)17(10,11)24-19)12-18-21-14(4,5)15(6,7)22-18/h12H2,1-11H3 |
| InChIKey | YQNJXCOSHQVONI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.09 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|