C35H62O2Se — CID 122215527
(2R)-2,8-dimethyl-5-octylselanyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-ol (PubChem CID 122215527) has the molecular formula C35H62O2Se and a molecular weight of 593.84 g/mol. Its IUPAC name is (2R)-2,8-dimethyl-5-octylselanyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-ol.
| Compound Name | (2R)-2,8-dimethyl-5-octylselanyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 122215527 |
| Molecular Formula | C35H62O2Se |
| Molecular Weight | 593.84 g/mol |
| Exact Mass | 594.39 |
| IUPAC Name | (2R)-2,8-dimethyl-5-octylselanyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-ol |
| SMILES | CCCCCCCC[Se]c1c(O)cc(C)c2c1CC[C@@](C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)O2 |
| InChI | InChI=1S/C35H62O2Se/c1-8-9-10-11-12-13-25-38-34-31-22-24-35(7,37-33(31)30(6)26-32(34)36)23-16-21-29(5)20-15-19-28(4)18-14-17-27(2)3/h26-29,36H,8-25H2,1-7H3/t28-,29-,35-/m1/s1 |
| InChIKey | XRYKPAXKALKTJG-SHHYTYQISA-N |
| XLogP | 10.33 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.84 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|