C20H28O — CID 122215800
2-[(E)-dec-5-enoxy]but-3-yn-2-ylbenzene (PubChem CID 122215800) has the molecular formula C20H28O and a molecular weight of 284.44 g/mol. Its IUPAC name is 2-[(E)-dec-5-enoxy]but-3-yn-2-ylbenzene.
| Compound Name | 2-[(E)-dec-5-enoxy]but-3-yn-2-ylbenzene |
|---|---|
| PubChem CID | 122215800 |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | 2-[(E)-dec-5-enoxy]but-3-yn-2-ylbenzene |
| SMILES | C#CC(C)(OCCCC/C=C/CCCC)c1ccccc1 |
| InChI | InChI=1S/C20H28O/c1-4-6-7-8-9-10-11-15-18-21-20(3,5-2)19-16-13-12-14-17-19/h2,8-9,12-14,16-17H,4,6-7,10-11,15,18H2,1,3H3/b9-8+ |
| InChIKey | SPFPSTYSFQZGPP-CMDGGOBGSA-N |
| XLogP | 5.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|