C17H22N2O3 — CID 122215815
4-[(1S,11bR)-1-nitro-2,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-1-yl]butan-2-one (PubChem CID 122215815) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 4-[(1S,11bR)-1-nitro-2,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-1-yl]butan-2-one.
| Compound Name | 4-[(1S,11bR)-1-nitro-2,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-1-yl]butan-2-one |
|---|---|
| PubChem CID | 122215815 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 4-[(1S,11bR)-1-nitro-2,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-1-yl]butan-2-one |
| SMILES | CC(=O)CC[C@@]1([N+](=O)[O-])CCCN2CCc3ccccc3[C@@H]21 |
| InChI | InChI=1S/C17H22N2O3/c1-13(20)7-10-17(19(21)22)9-4-11-18-12-8-14-5-2-3-6-15(14)16(17)18/h2-3,5-6,16H,4,7-12H2,1H3/t16-,17+/m1/s1 |
| InChIKey | SJGLSSQWWVIXGX-SJORKVTESA-N |
| XLogP | 2.76 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|