C18H23NO — CID 10308180
[(1R,12bR)-1-methyl-3,4,6,7,12,12b-hexahydro-2H-indeno[2,1-a]quinolizin-1-yl]methanol (PubChem CID 10308180) has the molecular formula C18H23NO and a molecular weight of 269.39 g/mol. Its IUPAC name is [(1R,12bR)-1-methyl-3,4,6,7,12,12b-hexahydro-2H-indeno[2,1-a]quinolizin-1-yl]methanol.
| Compound Name | [(1R,12bR)-1-methyl-3,4,6,7,12,12b-hexahydro-2H-indeno[2,1-a]quinolizin-1-yl]methanol |
|---|---|
| PubChem CID | 10308180 |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | [(1R,12bR)-1-methyl-3,4,6,7,12,12b-hexahydro-2H-indeno[2,1-a]quinolizin-1-yl]methanol |
| SMILES | C[C@@]1(CO)CCCN2CCC3=C(Cc4ccccc43)[C@@H]21 |
| InChI | InChI=1S/C18H23NO/c1-18(12-20)8-4-9-19-10-7-15-14-6-3-2-5-13(14)11-16(15)17(18)19/h2-3,5-6,17,20H,4,7-12H2,1H3/t17-,18+/m1/s1 |
| InChIKey | JZODTQUXELNFPH-MSOLQXFVSA-N |
| XLogP | 2.86 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |