C13H14O — CID 86734226
1-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyran (PubChem CID 86734226) has the molecular formula C13H14O and a molecular weight of 186.25 g/mol. Its IUPAC name is 1-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyran.
| Compound Name | 1-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyran |
|---|---|
| PubChem CID | 86734226 |
| Molecular Formula | C13H14O |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 1-methyl-1,3,4,9-tetrahydroindeno[2,1-c]pyran |
| SMILES | CC1OCCC2=C1Cc1ccccc12 |
| InChI | InChI=1S/C13H14O/c1-9-13-8-10-4-2-3-5-11(10)12(13)6-7-14-9/h2-5,9H,6-8H2,1H3 |
| InChIKey | QQMSCRGPTBBFOG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |