C33H36BN2O4S+ — CID 122217088
[3-[[2-[[3-[4-(dibutylamino)phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]methyl]-1,3-benzothiazol-3-ium-3-yl]methyl]phenyl]boronic acid (PubChem CID 122217088) has the molecular formula C33H36BN2O4S+ and a molecular weight of 567.54 g/mol. Its IUPAC name is [3-[[2-[[3-[4-(dibutylamino)phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]methyl]-1,3-benzothiazol-3-ium-3-yl]methyl]phenyl]boronic acid.
| Compound Name | [3-[[2-[[3-[4-(dibutylamino)phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]methyl]-1,3-benzothiazol-3-ium-3-yl]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 122217088 |
| Molecular Formula | C33H36BN2O4S+ |
| Molecular Weight | 567.54 g/mol |
| Exact Mass | 567.25 |
| IUPAC Name | [3-[[2-[[3-[4-(dibutylamino)phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-ylidene]methyl]-1,3-benzothiazol-3-ium-3-yl]methyl]phenyl]boronic acid |
| SMILES | CCCCN(CCCC)c1ccc(C2=C(O)C(=Cc3sc4ccccc4[n+]3Cc3cccc(B(O)O)c3)C2=O)cc1 |
| InChI | InChI=1S/C33H35BN2O4S/c1-3-5-18-35(19-6-4-2)26-16-14-24(15-17-26)31-32(37)27(33(31)38)21-30-36(28-12-7-8-13-29(28)41-30)22-23-10-9-11-25(20-23)34(39)40/h7-17,20-21,39-40H,3-6,18-19,22H2,1-2H3/p+1 |
| InChIKey | XGVXIUMJYLZOPZ-UHFFFAOYSA-O |
| XLogP | 5.26 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.54 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|