C24H33N3O — CID 122219340
(S)-(2-tert-butyl-6-methoxyquinolin-4-yl)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methanamine (PubChem CID 122219340) has the molecular formula C24H33N3O and a molecular weight of 379.55 g/mol. Its IUPAC name is (S)-(2-tert-butyl-6-methoxyquinolin-4-yl)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methanamine.
| Compound Name | (S)-(2-tert-butyl-6-methoxyquinolin-4-yl)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methanamine |
|---|---|
| PubChem CID | 122219340 |
| Molecular Formula | C24H33N3O |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.26 |
| IUPAC Name | (S)-(2-tert-butyl-6-methoxyquinolin-4-yl)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methanamine |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@@H](N)c1cc(C(C)(C)C)nc2ccc(OC)cc12 |
| InChI | InChI=1S/C24H33N3O/c1-6-15-14-27-10-9-16(15)11-21(27)23(25)19-13-22(24(2,3)4)26-20-8-7-17(28-5)12-18(19)20/h6-8,12-13,15-16,21,23H,1,9-11,14,25H2,2-5H3/t15-,16-,21-,23-/m0/s1 |
| InChIKey | LMFYMNIUSKAHAG-BAHGIXHPSA-N |
| XLogP | 4.44 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|