C30H35NSi — CID 122224652
2-(1-methyl-7-naphthalen-1-ylindol-6-yl)ethynyl-tri(propan-2-yl)silane (PubChem CID 122224652) has the molecular formula C30H35NSi and a molecular weight of 437.70 g/mol. Its IUPAC name is 2-(1-methyl-7-naphthalen-1-ylindol-6-yl)ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-(1-methyl-7-naphthalen-1-ylindol-6-yl)ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 122224652 |
| Molecular Formula | C30H35NSi |
| Molecular Weight | 437.70 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | 2-(1-methyl-7-naphthalen-1-ylindol-6-yl)ethynyl-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#Cc1ccc2ccn(C)c2c1-c1cccc2ccccc12)(C(C)C)C(C)C |
| InChI | InChI=1S/C30H35NSi/c1-21(2)32(22(3)4,23(5)6)20-18-25-15-16-26-17-19-31(7)30(26)29(25)28-14-10-12-24-11-8-9-13-27(24)28/h8-17,19,21-23H,1-7H3 |
| InChIKey | NNLPJPWHJBFKLI-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.70 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|