C15H18N6O — CID 122227286
[(1R,3R,4S)-3-azido-4-[4-(4-methylphenyl)triazol-1-yl]cyclopentyl]methanol (PubChem CID 122227286) has the molecular formula C15H18N6O and a molecular weight of 298.35 g/mol. Its IUPAC name is [(1R,3R,4S)-3-azido-4-[4-(4-methylphenyl)triazol-1-yl]cyclopentyl]methanol.
| Compound Name | [(1R,3R,4S)-3-azido-4-[4-(4-methylphenyl)triazol-1-yl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 122227286 |
| Molecular Formula | C15H18N6O |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | [(1R,3R,4S)-3-azido-4-[4-(4-methylphenyl)triazol-1-yl]cyclopentyl]methanol |
| SMILES | Cc1ccc(-c2cn([C@H]3C[C@@H](CO)C[C@H]3N=[N+]=[N-])nn2)cc1 |
| InChI | InChI=1S/C15H18N6O/c1-10-2-4-12(5-3-10)14-8-21(20-18-14)15-7-11(9-22)6-13(15)17-19-16/h2-5,8,11,13,15,22H,6-7,9H2,1H3/t11-,13+,15-/m0/s1 |
| InChIKey | TUTPPVDKFOCZLS-LNSITVRQSA-N |
| XLogP | 2.88 |
| TPSA | 99.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|