C9H14N4O3 — CID 22211267
1-[2-hydroxy-4-(hydroxymethyl)cyclopentyl]triazole-4-carboxamide (PubChem CID 22211267) has the molecular formula C9H14N4O3 and a molecular weight of 226.24 g/mol. Its IUPAC name is 1-[2-hydroxy-4-(hydroxymethyl)cyclopentyl]triazole-4-carboxamide.
| Compound Name | 1-[2-hydroxy-4-(hydroxymethyl)cyclopentyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 22211267 |
| Molecular Formula | C9H14N4O3 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 1-[2-hydroxy-4-(hydroxymethyl)cyclopentyl]triazole-4-carboxamide |
| SMILES | NC(=O)c1cn(C2CC(CO)CC2O)nn1 |
| InChI | InChI=1S/C9H14N4O3/c10-9(16)6-3-13(12-11-6)7-1-5(4-14)2-8(7)15/h3,5,7-8,14-15H,1-2,4H2,(H2,10,16) |
| InChIKey | MOZVYGRHXLVSPA-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |