C9H12N4O4 — CID 20846083
1-[4,5-dihydroxy-3-(hydroxymethyl)cyclopent-2-en-1-yl]triazole-4-carboxamide (PubChem CID 20846083) has the molecular formula C9H12N4O4 and a molecular weight of 240.22 g/mol. Its IUPAC name is 1-[4,5-dihydroxy-3-(hydroxymethyl)cyclopent-2-en-1-yl]triazole-4-carboxamide.
| Compound Name | 1-[4,5-dihydroxy-3-(hydroxymethyl)cyclopent-2-en-1-yl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 20846083 |
| Molecular Formula | C9H12N4O4 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 1-[4,5-dihydroxy-3-(hydroxymethyl)cyclopent-2-en-1-yl]triazole-4-carboxamide |
| SMILES | NC(=O)c1cn(C2C=C(CO)C(O)C2O)nn1 |
| InChI | InChI=1S/C9H12N4O4/c10-9(17)5-2-13(12-11-5)6-1-4(3-14)7(15)8(6)16/h1-2,6-8,14-16H,3H2,(H2,10,17) |
| InChIKey | MHXCOGJMZNSJBR-UHFFFAOYSA-N |
| XLogP | -2.43 |
| TPSA | 134.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|