C11H19N3O4 — CID 122233897
(2R)-2-amino-6-(2,2-dimethyl-3-oxido-5-oxoimidazol-3-ium-1-yl)hexanoic acid (PubChem CID 122233897) has the molecular formula C11H19N3O4 and a molecular weight of 257.29 g/mol. Its IUPAC name is (2R)-2-amino-6-(2,2-dimethyl-3-oxido-5-oxoimidazol-3-ium-1-yl)hexanoic acid.
| Compound Name | (2R)-2-amino-6-(2,2-dimethyl-3-oxido-5-oxoimidazol-3-ium-1-yl)hexanoic acid |
|---|---|
| PubChem CID | 122233897 |
| Molecular Formula | C11H19N3O4 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (2R)-2-amino-6-(2,2-dimethyl-3-oxido-5-oxoimidazol-3-ium-1-yl)hexanoic acid |
| SMILES | CC1(C)N(CCCC[C@@H](N)C(=O)O)C(=O)C=[N+]1[O-] |
| InChI | InChI=1S/C11H19N3O4/c1-11(2)13(9(15)7-14(11)18)6-4-3-5-8(12)10(16)17/h7-8H,3-6,12H2,1-2H3,(H,16,17)/t8-/m1/s1 |
| InChIKey | LIWPCSROWNMGNM-MRVPVSSYSA-N |
| XLogP | -0.27 |
| TPSA | 109.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|