C19H24N6O4 — CID 122294709
N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]-2-(2-oxo-1,3-oxazolidin-3-yl)acetamide (PubChem CID 122294709) has the molecular formula C19H24N6O4 and a molecular weight of 400.44 g/mol. Its IUPAC name is N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]-2-(2-oxo-1,3-oxazolidin-3-yl)acetamide.
| Compound Name | N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]-2-(2-oxo-1,3-oxazolidin-3-yl)acetamide |
|---|---|
| PubChem CID | 122294709 |
| Molecular Formula | C19H24N6O4 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | N-[2-[[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]amino]ethyl]-2-(2-oxo-1,3-oxazolidin-3-yl)acetamide |
| SMILES | COc1ccc(Nc2cc(C)nc(NCCNC(=O)CN3CCOC3=O)n2)cc1 |
| InChI | InChI=1S/C19H24N6O4/c1-13-11-16(23-14-3-5-15(28-2)6-4-14)24-18(22-13)21-8-7-20-17(26)12-25-9-10-29-19(25)27/h3-6,11H,7-10,12H2,1-2H3,(H,20,26)(H2,21,22,23,24) |
| InChIKey | GCNMKNIIQUIJDP-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 117.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|