C13H14O2 — CID 122361282
(2'S,3R)-2'-ethylspiro[2H-1-benzofuran-3,5'-2H-furan] (PubChem CID 122361282) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is (2'S,3R)-2'-ethylspiro[2H-1-benzofuran-3,5'-2H-furan].
| Compound Name | (2'S,3R)-2'-ethylspiro[2H-1-benzofuran-3,5'-2H-furan] |
|---|---|
| PubChem CID | 122361282 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | (2'S,3R)-2'-ethylspiro[2H-1-benzofuran-3,5'-2H-furan] |
| SMILES | CC[C@H]1C=C[C@@]2(COc3ccccc32)O1 |
| InChI | InChI=1S/C13H14O2/c1-2-10-7-8-13(15-10)9-14-12-6-4-3-5-11(12)13/h3-8,10H,2,9H2,1H3/t10-,13-/m0/s1 |
| InChIKey | VPHXJEMZFAHYCY-GWCFXTLKSA-N |
| XLogP | 2.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|