C19H24N2S — CID 122363989
phenyl N'-(2,6-dimethylphenyl)-N,N-diethylcarbamimidothioate (PubChem CID 122363989) has the molecular formula C19H24N2S and a molecular weight of 312.48 g/mol. Its IUPAC name is phenyl N'-(2,6-dimethylphenyl)-N,N-diethylcarbamimidothioate.
| Compound Name | phenyl N'-(2,6-dimethylphenyl)-N,N-diethylcarbamimidothioate |
|---|---|
| PubChem CID | 122363989 |
| Molecular Formula | C19H24N2S |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | phenyl N'-(2,6-dimethylphenyl)-N,N-diethylcarbamimidothioate |
| SMILES | CCN(CC)/C(=N/c1c(C)cccc1C)Sc1ccccc1 |
| InChI | InChI=1S/C19H24N2S/c1-5-21(6-2)19(22-17-13-8-7-9-14-17)20-18-15(3)11-10-12-16(18)4/h7-14H,5-6H2,1-4H3/b20-19- |
| InChIKey | OJMZLXIFVKDGIL-VXPUYCOJSA-N |
| XLogP | 5.43 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|